C24H36N4O2S — CID 142474750
N-(4-tert-butylphenyl)-3-phenylpropanamide;pyrrolidine-2-carboxamide;thiohydroxylamine (PubChem CID 142474750) has the molecular formula C24H36N4O2S and a molecular weight of 444.65 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3-phenylpropanamide;pyrrolidine-2-carboxamide;thiohydroxylamine.
| Compound Name | N-(4-tert-butylphenyl)-3-phenylpropanamide;pyrrolidine-2-carboxamide;thiohydroxylamine |
|---|---|
| PubChem CID | 142474750 |
| Molecular Formula | C24H36N4O2S |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | N-(4-tert-butylphenyl)-3-phenylpropanamide;pyrrolidine-2-carboxamide;thiohydroxylamine |
| SMILES | CC(C)(C)c1ccc(NC(=O)CCc2ccccc2)cc1.NC(=O)C1CCCN1.NS |
| InChI | InChI=1S/C19H23NO.C5H10N2O.H3NS/c1-19(2,3)16-10-12-17(13-11-16)20-18(21)14-9-15-7-5-4-6-8-15;6-5(8)4-2-1-3-7-4;1-2/h4-8,10-13H,9,14H2,1-3H3,(H,20,21);4,7H,1-3H2,(H2,6,8);2H,1H2 |
| InChIKey | ZFURRVBBFVQCEX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|