C21H32ClNO — CID 142475127
1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-methylpiperidin-4-ol (PubChem CID 142475127) has the molecular formula C21H32ClNO and a molecular weight of 349.95 g/mol. Its IUPAC name is 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-methylpiperidin-4-ol.
| Compound Name | 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 142475127 |
| Molecular Formula | C21H32ClNO |
| Molecular Weight | 349.95 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-[6-(4-chlorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-methylpiperidin-4-ol |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(Cl)cc1)N1CCC(C)(O)CC1 |
| InChI | InChI=1S/C21H32ClNO/c1-16(2)14-19(23-12-10-21(5,24)11-13-23)15-20(3,4)17-6-8-18(22)9-7-17/h6-9,14,19,24H,10-13,15H2,1-5H3 |
| InChIKey | AJBYJQPTXFHWHH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|