C21H29F4N — CID 142475171
1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(trifluoromethyl)piperidine (PubChem CID 142475171) has the molecular formula C21H29F4N and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 142475171 |
| Molecular Formula | C21H29F4N |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-[6-(4-fluorophenyl)-2,6-dimethylhept-2-en-4-yl]-4-(trifluoromethyl)piperidine |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(F)cc1)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H29F4N/c1-15(2)13-19(26-11-9-17(10-12-26)21(23,24)25)14-20(3,4)16-5-7-18(22)8-6-16/h5-8,13,17,19H,9-12,14H2,1-4H3 |
| InChIKey | ILIUYSODVLEVCT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|