C18H24O2 — CID 142475667
(4'E,5'E,6S)-4'-butylidene-5'-ethylidene-6-methylspiro[bicyclo[4.2.0]oct-1-ene-8,2'-oxolane]-3'-one (PubChem CID 142475667) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (4'E,5'E,6S)-4'-butylidene-5'-ethylidene-6-methylspiro[bicyclo[4.2.0]oct-1-ene-8,2'-oxolane]-3'-one.
| Compound Name | (4'E,5'E,6S)-4'-butylidene-5'-ethylidene-6-methylspiro[bicyclo[4.2.0]oct-1-ene-8,2'-oxolane]-3'-one |
|---|---|
| PubChem CID | 142475667 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (4'E,5'E,6S)-4'-butylidene-5'-ethylidene-6-methylspiro[bicyclo[4.2.0]oct-1-ene-8,2'-oxolane]-3'-one |
| SMILES | C/C=C1/OC2(C[C@]3(C)CCCC=C23)C(=O)/C1=C/CCC |
| InChI | InChI=1S/C18H24O2/c1-4-6-9-13-14(5-2)20-18(16(13)19)12-17(3)11-8-7-10-15(17)18/h5,9-10H,4,6-8,11-12H2,1-3H3/b13-9+,14-5+/t17-,18?/m0/s1 |
| InChIKey | IPZGLFZITSVBFO-XHEWYFPHSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|