C15H17N5O2 — CID 142478286
6-amino-1-methyl-4-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]quinolin-2-one (PubChem CID 142478286) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 6-amino-1-methyl-4-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]quinolin-2-one.
| Compound Name | 6-amino-1-methyl-4-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]quinolin-2-one |
|---|---|
| PubChem CID | 142478286 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 6-amino-1-methyl-4-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]quinolin-2-one |
| SMILES | Cc1nnc(C(C)Nc2cc(=O)n(C)c3ccc(N)cc23)o1 |
| InChI | InChI=1S/C15H17N5O2/c1-8(15-19-18-9(2)22-15)17-12-7-14(21)20(3)13-5-4-10(16)6-11(12)13/h4-8,17H,16H2,1-3H3 |
| InChIKey | KWGNFKWHOAEMLB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|