C21H21F3N6O4 — CID 142478415
1-methyl-6-nitro-4-[1-[5-[2-(trifluoromethyl)morpholin-4-yl]pyrimidin-2-yl]ethylamino]quinolin-2-one (PubChem CID 142478415) has the molecular formula C21H21F3N6O4 and a molecular weight of 478.43 g/mol. Its IUPAC name is 1-methyl-6-nitro-4-[1-[5-[2-(trifluoromethyl)morpholin-4-yl]pyrimidin-2-yl]ethylamino]quinolin-2-one.
| Compound Name | 1-methyl-6-nitro-4-[1-[5-[2-(trifluoromethyl)morpholin-4-yl]pyrimidin-2-yl]ethylamino]quinolin-2-one |
|---|---|
| PubChem CID | 142478415 |
| Molecular Formula | C21H21F3N6O4 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 1-methyl-6-nitro-4-[1-[5-[2-(trifluoromethyl)morpholin-4-yl]pyrimidin-2-yl]ethylamino]quinolin-2-one |
| SMILES | CC(Nc1cc(=O)n(C)c2ccc([N+](=O)[O-])cc12)c1ncc(N2CCOC(C(F)(F)F)C2)cn1 |
| InChI | InChI=1S/C21H21F3N6O4/c1-12(20-25-9-14(10-26-20)29-5-6-34-18(11-29)21(22,23)24)27-16-8-19(31)28(2)17-4-3-13(30(32)33)7-15(16)17/h3-4,7-10,12,18,27H,5-6,11H2,1-2H3 |
| InChIKey | ZEJTYMOUDNPRSE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|