About ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane
ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane (PubChem CID 142479284) has the molecular formula C18H29NO
and a molecular weight of 275.44 g/mol. Its IUPAC name is ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane.
Molecular Properties
| Compound Name | ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane |
| PubChem CID | 142479284 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane |
| SMILES | CC.Cc1ccc(C2CC2CN2CCCOCC2)cc1 |
| InChI | InChI=1S/C16H23NO.C2H6/c1-13-3-5-14(6-4-13)16-11-15(16)12-17-7-2-9-18-10-8-17;1-2/h3-6,15-16H,2,7-12H2,1H3;1-2H3 |
| InChIKey | ZEPXSAAQFVOZPG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane?
The IUPAC name of ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane (CID 142479284) is ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane.
What is the SMILES notation for ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane?
The canonical SMILES for ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane is CC.Cc1ccc(C2CC2CN2CCCOCC2)cc1.
What is the InChIKey of ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane?
The InChIKey is ZEPXSAAQFVOZPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO.C2H6/c1-13-3-5-14(6-4-13)16-11-15(16)12-17-7-2-9-18-10-8-17;1-2/h3-6,15-16H,2,7-12H2,1H3;1-2H3.
What are the key properties of ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane?
ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane has a molecular weight of 275.44 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[[2-(4-methylphenyl)cyclopropyl]methyl]-1,4-oxazepane is sourced from PubChem (CID 142479284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).