C13H13N3O3 — CID 142479390
[(1S)-1-[1-[(5-ethynyl-1,2-oxazol-3-yl)methyl]imidazol-2-yl]ethyl] acetate (PubChem CID 142479390) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is [(1S)-1-[1-[(5-ethynyl-1,2-oxazol-3-yl)methyl]imidazol-2-yl]ethyl] acetate.
| Compound Name | [(1S)-1-[1-[(5-ethynyl-1,2-oxazol-3-yl)methyl]imidazol-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 142479390 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | [(1S)-1-[1-[(5-ethynyl-1,2-oxazol-3-yl)methyl]imidazol-2-yl]ethyl] acetate |
| SMILES | C#Cc1cc(Cn2ccnc2[C@H](C)OC(C)=O)no1 |
| InChI | InChI=1S/C13H13N3O3/c1-4-12-7-11(15-19-12)8-16-6-5-14-13(16)9(2)18-10(3)17/h1,5-7,9H,8H2,2-3H3/t9-/m0/s1 |
| InChIKey | UWPMNAVDUKSDTJ-VIFPVBQESA-N |
| XLogP | 1.52 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|