C19H19N3O3 — CID 142479805
1-[4-[2-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]ethanol (PubChem CID 142479805) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-[4-[2-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]ethanol.
| Compound Name | 1-[4-[2-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]ethanol |
|---|---|
| PubChem CID | 142479805 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-[4-[2-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]ethanol |
| SMILES | CC(O)c1ccc(C#Cc2cc(Cn3ccnc3[C@H](C)O)no2)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-13(23)16-6-3-15(4-7-16)5-8-18-11-17(21-25-18)12-22-10-9-20-19(22)14(2)24/h3-4,6-7,9-11,13-14,23-24H,12H2,1-2H3/t13?,14-/m0/s1 |
| InChIKey | JEPAOYHINQMYGY-KZUDCZAMSA-N |
| XLogP | 2.43 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|