C24H30IN4O3P — CID 142479649
ethane;N-[1-[4-[2-[3-[[2-[(1S)-1-iodophosphanyloxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]ethyl]oxetan-3-amine (PubChem CID 142479649) has the molecular formula C24H30IN4O3P and a molecular weight of 580.41 g/mol. Its IUPAC name is ethane;N-[1-[4-[2-[3-[[2-[(1S)-1-iodophosphanyloxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]ethyl]oxetan-3-amine.
| Compound Name | ethane;N-[1-[4-[2-[3-[[2-[(1S)-1-iodophosphanyloxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]ethyl]oxetan-3-amine |
|---|---|
| PubChem CID | 142479649 |
| Molecular Formula | C24H30IN4O3P |
| Molecular Weight | 580.41 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | ethane;N-[1-[4-[2-[3-[[2-[(1S)-1-iodophosphanyloxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]ethyl]oxetan-3-amine |
| SMILES | CC.CC(NC1COC1)c1ccc(C#Cc2cc(Cn3ccnc3[C@H](C)OPI)no2)cc1 |
| InChI | InChI=1S/C22H24IN4O3P.C2H6/c1-15(25-20-13-28-14-20)18-6-3-17(4-7-18)5-8-21-11-19(26-29-21)12-27-10-9-24-22(27)16(2)30-31-23;1-2/h3-4,6-7,9-11,15-16,20,25,31H,12-14H2,1-2H3;1-2H3/t15?,16-;/m0./s1 |
| InChIKey | PVEYQFVQECMHKU-UFUZRDLVSA-N |
| XLogP | 5.42 |
| TPSA | 74.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|