C21H22N4O2 — CID 142479488
azetidin-3-yl-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]methanol (PubChem CID 142479488) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is azetidin-3-yl-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]methanol.
| Compound Name | azetidin-3-yl-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]methanol |
|---|---|
| PubChem CID | 142479488 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | azetidin-3-yl-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]methanol |
| SMILES | CCc1nccn1Cc1cc(C#Cc2ccc(C(O)C3CNC3)cc2)on1 |
| InChI | InChI=1S/C21H22N4O2/c1-2-20-23-9-10-25(20)14-18-11-19(27-24-18)8-5-15-3-6-16(7-4-15)21(26)17-12-22-13-17/h3-4,6-7,9-11,17,21-22,26H,2,12-14H2,1H3 |
| InChIKey | VLEPRZKURNMDMR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|