C20H20N4O2 — CID 142479570
3-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]azetidin-3-ol (PubChem CID 142479570) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]azetidin-3-ol.
| Compound Name | 3-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]azetidin-3-ol |
|---|---|
| PubChem CID | 142479570 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 3-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]azetidin-3-ol |
| SMILES | CCc1nccn1Cc1cc(C#Cc2ccc(C3(O)CNC3)cc2)on1 |
| InChI | InChI=1S/C20H20N4O2/c1-2-19-22-9-10-24(19)12-17-11-18(26-23-17)8-5-15-3-6-16(7-4-15)20(25)13-21-14-20/h3-4,6-7,9-11,21,25H,2,12-14H2,1H3 |
| InChIKey | YGLFKUUXRHVUGU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|