C22H23N3O3 — CID 142479455
3-[(2-ethylimidazol-1-yl)methyl]-5-[2-[4-(2-methoxyoxolan-2-yl)phenyl]ethynyl]-1,2-oxazole (PubChem CID 142479455) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-[(2-ethylimidazol-1-yl)methyl]-5-[2-[4-(2-methoxyoxolan-2-yl)phenyl]ethynyl]-1,2-oxazole.
| Compound Name | 3-[(2-ethylimidazol-1-yl)methyl]-5-[2-[4-(2-methoxyoxolan-2-yl)phenyl]ethynyl]-1,2-oxazole |
|---|---|
| PubChem CID | 142479455 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-[(2-ethylimidazol-1-yl)methyl]-5-[2-[4-(2-methoxyoxolan-2-yl)phenyl]ethynyl]-1,2-oxazole |
| SMILES | CCc1nccn1Cc1cc(C#Cc2ccc(C3(OC)CCCO3)cc2)on1 |
| InChI | InChI=1S/C22H23N3O3/c1-3-21-23-12-13-25(21)16-19-15-20(28-24-19)10-7-17-5-8-18(9-6-17)22(26-2)11-4-14-27-22/h5-6,8-9,12-13,15H,3-4,11,14,16H2,1-2H3 |
| InChIKey | NQIOLMQABGAHJK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|