C30H32N4O3 — CID 142479801
4-[3-[4-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]phenoxy]propyl]morpholine (PubChem CID 142479801) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 4-[3-[4-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]phenoxy]propyl]morpholine.
| Compound Name | 4-[3-[4-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]phenoxy]propyl]morpholine |
|---|---|
| PubChem CID | 142479801 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 4-[3-[4-[4-[2-[3-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-5-yl]ethynyl]phenyl]phenoxy]propyl]morpholine |
| SMILES | CCc1nccn1Cc1cc(C#Cc2ccc(-c3ccc(OCCCN4CCOCC4)cc3)cc2)on1 |
| InChI | InChI=1S/C30H32N4O3/c1-2-30-31-14-16-34(30)23-27-22-29(37-32-27)11-6-24-4-7-25(8-5-24)26-9-12-28(13-10-26)36-19-3-15-33-17-20-35-21-18-33/h4-5,7-10,12-14,16,22H,2-3,15,17-21,23H2,1H3 |
| InChIKey | AAJSIOBQVPKLIJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|