C24H26F2N4O3 — CID 162610156
(1S)-1-[1-[[5-[2-[4-[3-(2,2-difluoropyrrolidin-1-yl)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol (PubChem CID 162610156) has the molecular formula C24H26F2N4O3 and a molecular weight of 456.49 g/mol. Its IUPAC name is (1S)-1-[1-[[5-[2-[4-[3-(2,2-difluoropyrrolidin-1-yl)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol.
| Compound Name | (1S)-1-[1-[[5-[2-[4-[3-(2,2-difluoropyrrolidin-1-yl)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 162610156 |
| Molecular Formula | C24H26F2N4O3 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (1S)-1-[1-[[5-[2-[4-[3-(2,2-difluoropyrrolidin-1-yl)propoxy]phenyl]ethynyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol |
| SMILES | C[C@H](O)c1nccn1Cc1cc(C#Cc2ccc(OCCCN3CCCC3(F)F)cc2)on1 |
| InChI | InChI=1S/C24H26F2N4O3/c1-18(31)23-27-11-14-29(23)17-20-16-22(33-28-20)9-6-19-4-7-21(8-5-19)32-15-3-13-30-12-2-10-24(30,25)26/h4-5,7-8,11,14,16,18,31H,2-3,10,12-13,15,17H2,1H3/t18-/m0/s1 |
| InChIKey | UZQWUEWXOSIZLD-SFHVURJKSA-N |
| XLogP | 3.83 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|