C17H24BrN3O2Si — CID 162092882
1-[1-[[5-(2-bromoethynyl)-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 162092882) has the molecular formula C17H24BrN3O2Si and a molecular weight of 410.39 g/mol. Its IUPAC name is 1-[1-[[5-(2-bromoethynyl)-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 1-[1-[[5-(2-bromoethynyl)-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 162092882 |
| Molecular Formula | C17H24BrN3O2Si |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 1-[1-[[5-(2-bromoethynyl)-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)c1nccn1Cc1cc(C#CBr)on1 |
| InChI | InChI=1S/C17H24BrN3O2Si/c1-13(23-24(5,6)17(2,3)4)16-19-9-10-21(16)12-14-11-15(7-8-18)22-20-14/h9-11,13H,12H2,1-6H3 |
| InChIKey | ZDVVRWYOIDUYPF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|