C26H32N2O3 — CID 142480160
3-amino-1-[4-[[4-[2-[4-(hydroxymethyl)phenyl]ethynyl]phenyl]methyl]piperidin-1-yl]propan-1-one;ethenol (PubChem CID 142480160) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 3-amino-1-[4-[[4-[2-[4-(hydroxymethyl)phenyl]ethynyl]phenyl]methyl]piperidin-1-yl]propan-1-one;ethenol.
| Compound Name | 3-amino-1-[4-[[4-[2-[4-(hydroxymethyl)phenyl]ethynyl]phenyl]methyl]piperidin-1-yl]propan-1-one;ethenol |
|---|---|
| PubChem CID | 142480160 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 3-amino-1-[4-[[4-[2-[4-(hydroxymethyl)phenyl]ethynyl]phenyl]methyl]piperidin-1-yl]propan-1-one;ethenol |
| SMILES | C=CO.NCCC(=O)N1CCC(Cc2ccc(C#Cc3ccc(CO)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H28N2O2.C2H4O/c25-14-11-24(28)26-15-12-22(13-16-26)17-21-7-3-19(4-8-21)1-2-20-5-9-23(18-27)10-6-20;1-2-3/h3-10,22,27H,11-18,25H2;2-3H,1H2 |
| InChIKey | MXYODUYHUJRDRN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|