C21H16ClFN4O2 — CID 142482387
1-[4-(1-chloro-10-fluoro-[1]benzofuro[3,2-g]phthalazin-4-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 142482387) has the molecular formula C21H16ClFN4O2 and a molecular weight of 410.84 g/mol. Its IUPAC name is 1-[4-(1-chloro-10-fluoro-[1]benzofuro[3,2-g]phthalazin-4-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(1-chloro-10-fluoro-[1]benzofuro[3,2-g]phthalazin-4-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142482387 |
| Molecular Formula | C21H16ClFN4O2 |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 1-[4-(1-chloro-10-fluoro-[1]benzofuro[3,2-g]phthalazin-4-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nnc(Cl)c3cc4c(cc23)oc2cccc(F)c24)CC1 |
| InChI | InChI=1S/C21H16ClFN4O2/c1-2-18(28)26-6-8-27(9-7-26)21-13-11-17-14(10-12(13)20(22)24-25-21)19-15(23)4-3-5-16(19)29-17/h2-5,10-11H,1,6-9H2 |
| InChIKey | NMWWYQOIEWPRJW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|