C20H26ClN5OS — CID 142482907
[2-[(4-chlorophenyl)methyl]-2,8-diazaspiro[4.5]decan-8-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone (PubChem CID 142482907) has the molecular formula C20H26ClN5OS and a molecular weight of 419.98 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methyl]-2,8-diazaspiro[4.5]decan-8-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone.
| Compound Name | [2-[(4-chlorophenyl)methyl]-2,8-diazaspiro[4.5]decan-8-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 142482907 |
| Molecular Formula | C20H26ClN5OS |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [2-[(4-chlorophenyl)methyl]-2,8-diazaspiro[4.5]decan-8-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone |
| SMILES | CSNc1ccn(C(=O)N2CCC3(CCN(Cc4ccc(Cl)cc4)C3)CC2)n1 |
| InChI | InChI=1S/C20H26ClN5OS/c1-28-23-18-6-10-26(22-18)19(27)25-12-8-20(9-13-25)7-11-24(15-20)14-16-2-4-17(21)5-3-16/h2-6,10H,7-9,11-15H2,1H3,(H,22,23) |
| InChIKey | JIWWIOMDJFEZST-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|