C20H27ClN6O2S — CID 145315789
[4-[(3-chloro-4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone (PubChem CID 145315789) has the molecular formula C20H27ClN6O2S and a molecular weight of 451.00 g/mol. Its IUPAC name is [4-[(3-chloro-4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone.
| Compound Name | [4-[(3-chloro-4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 145315789 |
| Molecular Formula | C20H27ClN6O2S |
| Molecular Weight | 451.00 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [4-[(3-chloro-4-morpholin-4-ylphenyl)methyl]piperazin-1-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone |
| SMILES | CSNc1ccn(C(=O)N2CCN(Cc3ccc(N4CCOCC4)c(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C20H27ClN6O2S/c1-30-23-19-4-5-27(22-19)20(28)26-8-6-24(7-9-26)15-16-2-3-18(17(21)14-16)25-10-12-29-13-11-25/h2-5,14H,6-13,15H2,1H3,(H,22,23) |
| InChIKey | VGVUTICDHKTJPA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.00 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|