C20H27ClN6OS — CID 145315810
[4-[(4-chloro-2-pyrrolidin-1-ylphenyl)methyl]piperazin-1-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone (PubChem CID 145315810) has the molecular formula C20H27ClN6OS and a molecular weight of 435.00 g/mol. Its IUPAC name is [4-[(4-chloro-2-pyrrolidin-1-ylphenyl)methyl]piperazin-1-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone.
| Compound Name | [4-[(4-chloro-2-pyrrolidin-1-ylphenyl)methyl]piperazin-1-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 145315810 |
| Molecular Formula | C20H27ClN6OS |
| Molecular Weight | 435.00 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | [4-[(4-chloro-2-pyrrolidin-1-ylphenyl)methyl]piperazin-1-yl]-[3-(methylsulfanylamino)pyrazol-1-yl]methanone |
| SMILES | CSNc1ccn(C(=O)N2CCN(Cc3ccc(Cl)cc3N3CCCC3)CC2)n1 |
| InChI | InChI=1S/C20H27ClN6OS/c1-29-23-19-6-9-27(22-19)20(28)26-12-10-24(11-13-26)15-16-4-5-17(21)14-18(16)25-7-2-3-8-25/h4-6,9,14H,2-3,7-8,10-13,15H2,1H3,(H,22,23) |
| InChIKey | IVCJICYZQVCFNP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.00 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|