C19H27N7OS — CID 142483135
[3-(methylsulfanylamino)pyrazol-1-yl]-[4-[(2-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazin-1-yl]methanone (PubChem CID 142483135) has the molecular formula C19H27N7OS and a molecular weight of 401.54 g/mol. Its IUPAC name is [3-(methylsulfanylamino)pyrazol-1-yl]-[4-[(2-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [3-(methylsulfanylamino)pyrazol-1-yl]-[4-[(2-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 142483135 |
| Molecular Formula | C19H27N7OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [3-(methylsulfanylamino)pyrazol-1-yl]-[4-[(2-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazin-1-yl]methanone |
| SMILES | CSNc1ccn(C(=O)N2CCN(Cc3cccnc3N3CCCC3)CC2)n1 |
| InChI | InChI=1S/C19H27N7OS/c1-28-22-17-6-10-26(21-17)19(27)25-13-11-23(12-14-25)15-16-5-4-7-20-18(16)24-8-2-3-9-24/h4-7,10H,2-3,8-9,11-15H2,1H3,(H,21,22) |
| InChIKey | JKPXQRBQEKYNCF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|