C14H21ClN4 — CID 142484560
6-chloro-1-cyclohexyl-3-methylpyrazolo[3,4-b]pyrazine;ethane (PubChem CID 142484560) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is 6-chloro-1-cyclohexyl-3-methylpyrazolo[3,4-b]pyrazine;ethane.
| Compound Name | 6-chloro-1-cyclohexyl-3-methylpyrazolo[3,4-b]pyrazine;ethane |
|---|---|
| PubChem CID | 142484560 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 6-chloro-1-cyclohexyl-3-methylpyrazolo[3,4-b]pyrazine;ethane |
| SMILES | CC.Cc1nn(C2CCCCC2)c2nc(Cl)cnc12 |
| InChI | InChI=1S/C12H15ClN4.C2H6/c1-8-11-12(15-10(13)7-14-11)17(16-8)9-5-3-2-4-6-9;1-2/h7,9H,2-6H2,1H3;1-2H3 |
| InChIKey | LNNVWMBGCGRFOF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |