C9H9ClN4 — CID 175891792
6-chloro-1-cyclobutylpyrazolo[3,4-b]pyrazine (PubChem CID 175891792) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 6-chloro-1-cyclobutylpyrazolo[3,4-b]pyrazine.
| Compound Name | 6-chloro-1-cyclobutylpyrazolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 175891792 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 6-chloro-1-cyclobutylpyrazolo[3,4-b]pyrazine |
| SMILES | Clc1cnc2cnn(C3CCC3)c2n1 |
| InChI | InChI=1S/C9H9ClN4/c10-8-5-11-7-4-12-14(9(7)13-8)6-2-1-3-6/h4-6H,1-3H2 |
| InChIKey | XBRVQHQFZOYEBC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |