C6H12N4 — CID 142484897
1,4-diaminopiperidine-4-carbonitrile (PubChem CID 142484897) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 1,4-diaminopiperidine-4-carbonitrile.
| Compound Name | 1,4-diaminopiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 142484897 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 1,4-diaminopiperidine-4-carbonitrile |
| SMILES | N#CC1(N)CCN(N)CC1 |
| InChI | InChI=1S/C6H12N4/c7-5-6(8)1-3-10(9)4-2-6/h1-4,8-9H2 |
| InChIKey | JMASWLNZQDIXQI-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 79.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|