C16H13N5S2 — CID 142485765
3-amino-4-(3-methylimidazol-4-yl)-6-pyridin-3-ylthieno[2,3-b]pyridine-2-thiol (PubChem CID 142485765) has the molecular formula C16H13N5S2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 3-amino-4-(3-methylimidazol-4-yl)-6-pyridin-3-ylthieno[2,3-b]pyridine-2-thiol.
| Compound Name | 3-amino-4-(3-methylimidazol-4-yl)-6-pyridin-3-ylthieno[2,3-b]pyridine-2-thiol |
|---|---|
| PubChem CID | 142485765 |
| Molecular Formula | C16H13N5S2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 3-amino-4-(3-methylimidazol-4-yl)-6-pyridin-3-ylthieno[2,3-b]pyridine-2-thiol |
| SMILES | Cn1cncc1-c1cc(-c2cccnc2)nc2sc(S)c(N)c12 |
| InChI | InChI=1S/C16H13N5S2/c1-21-8-19-7-12(21)10-5-11(9-3-2-4-18-6-9)20-15-13(10)14(17)16(22)23-15/h2-8,22H,17H2,1H3 |
| InChIKey | AQSACXUXNWWPFE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|