C23H25N5S2 — CID 142485771
2-butylsulfanyl-4-(2-cyclopropyl-3-methylimidazol-4-yl)-6-pyridin-3-ylthieno[2,3-b]pyridin-3-amine (PubChem CID 142485771) has the molecular formula C23H25N5S2 and a molecular weight of 435.62 g/mol. Its IUPAC name is 2-butylsulfanyl-4-(2-cyclopropyl-3-methylimidazol-4-yl)-6-pyridin-3-ylthieno[2,3-b]pyridin-3-amine.
| Compound Name | 2-butylsulfanyl-4-(2-cyclopropyl-3-methylimidazol-4-yl)-6-pyridin-3-ylthieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 142485771 |
| Molecular Formula | C23H25N5S2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-butylsulfanyl-4-(2-cyclopropyl-3-methylimidazol-4-yl)-6-pyridin-3-ylthieno[2,3-b]pyridin-3-amine |
| SMILES | CCCCSc1sc2nc(-c3cccnc3)cc(-c3cnc(C4CC4)n3C)c2c1N |
| InChI | InChI=1S/C23H25N5S2/c1-3-4-10-29-23-20(24)19-16(18-13-26-21(28(18)2)14-7-8-14)11-17(27-22(19)30-23)15-6-5-9-25-12-15/h5-6,9,11-14H,3-4,7-8,10,24H2,1-2H3 |
| InChIKey | AEZLJLKRBBZSOC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|