C22H23N5S2 — CID 142485810
6-(2-aminopyrimidin-5-yl)-2-butylsulfanyl-N-methyl-4-phenylthieno[2,3-b]pyridin-3-amine (PubChem CID 142485810) has the molecular formula C22H23N5S2 and a molecular weight of 421.60 g/mol. Its IUPAC name is 6-(2-aminopyrimidin-5-yl)-2-butylsulfanyl-N-methyl-4-phenylthieno[2,3-b]pyridin-3-amine.
| Compound Name | 6-(2-aminopyrimidin-5-yl)-2-butylsulfanyl-N-methyl-4-phenylthieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 142485810 |
| Molecular Formula | C22H23N5S2 |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 6-(2-aminopyrimidin-5-yl)-2-butylsulfanyl-N-methyl-4-phenylthieno[2,3-b]pyridin-3-amine |
| SMILES | CCCCSc1sc2nc(-c3cnc(N)nc3)cc(-c3ccccc3)c2c1NC |
| InChI | InChI=1S/C22H23N5S2/c1-3-4-10-28-21-19(24-2)18-16(14-8-6-5-7-9-14)11-17(27-20(18)29-21)15-12-25-22(23)26-13-15/h5-9,11-13,24H,3-4,10H2,1-2H3,(H2,23,25,26) |
| InChIKey | UJPLIGRNFLYNEK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|