C18H19N5S3 — CID 170737991
2-butylsulfanyl-4-(1-methylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine (PubChem CID 170737991) has the molecular formula C18H19N5S3 and a molecular weight of 401.59 g/mol. Its IUPAC name is 2-butylsulfanyl-4-(1-methylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine.
| Compound Name | 2-butylsulfanyl-4-(1-methylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 170737991 |
| Molecular Formula | C18H19N5S3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-butylsulfanyl-4-(1-methylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
| SMILES | CCCCSc1sc2nc(-c3nccs3)cc(-c3cn(C)cn3)c2c1N |
| InChI | InChI=1S/C18H19N5S3/c1-3-4-6-25-18-15(19)14-11(13-9-23(2)10-21-13)8-12(22-17(14)26-18)16-20-5-7-24-16/h5,7-10H,3-4,6,19H2,1-2H3 |
| InChIKey | QOHWXEPIIYCMJG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|