C24H24N4OS3 — CID 142485815
3-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]-N-prop-2-enylbenzamide (PubChem CID 142485815) has the molecular formula C24H24N4OS3 and a molecular weight of 480.68 g/mol. Its IUPAC name is 3-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]-N-prop-2-enylbenzamide.
| Compound Name | 3-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 142485815 |
| Molecular Formula | C24H24N4OS3 |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 3-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(-c2cc(-c3nccs3)nc3sc(SCCCC)c(N)c23)c1 |
| InChI | InChI=1S/C24H24N4OS3/c1-3-5-11-31-24-20(25)19-17(14-18(28-23(19)32-24)22-27-10-12-30-22)15-7-6-8-16(13-15)21(29)26-9-4-2/h4,6-8,10,12-14H,2-3,5,9,11,25H2,1H3,(H,26,29) |
| InChIKey | DAPVITKVIIOQNT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|