C23H25N3O2S3 — CID 142485751
4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]benzoic acid;ethane (PubChem CID 142485751) has the molecular formula C23H25N3O2S3 and a molecular weight of 471.67 g/mol. Its IUPAC name is 4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]benzoic acid;ethane.
| Compound Name | 4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]benzoic acid;ethane |
|---|---|
| PubChem CID | 142485751 |
| Molecular Formula | C23H25N3O2S3 |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]benzoic acid;ethane |
| SMILES | CC.CCCCSc1sc2nc(-c3nccs3)cc(-c3ccc(C(=O)O)cc3)c2c1N |
| InChI | InChI=1S/C21H19N3O2S3.C2H6/c1-2-3-9-28-21-17(22)16-14(12-4-6-13(7-5-12)20(25)26)11-15(24-19(16)29-21)18-23-8-10-27-18;1-2/h4-8,10-11H,2-3,9,22H2,1H3,(H,25,26);1-2H3 |
| InChIKey | QOUWELKTXUPZHK-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|