C23H22BrN3O2S3 — CID 144839659
ethyl 3-amino-4-(4-bromophenyl)-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridine-5-carboxylate (PubChem CID 144839659) has the molecular formula C23H22BrN3O2S3 and a molecular weight of 548.55 g/mol. Its IUPAC name is ethyl 3-amino-4-(4-bromophenyl)-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridine-5-carboxylate.
| Compound Name | ethyl 3-amino-4-(4-bromophenyl)-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 144839659 |
| Molecular Formula | C23H22BrN3O2S3 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 547.01 |
| IUPAC Name | ethyl 3-amino-4-(4-bromophenyl)-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridine-5-carboxylate |
| SMILES | CCCCSc1sc2nc(-c3nccs3)c(C(=O)OCC)c(-c3ccc(Br)cc3)c2c1N |
| InChI | InChI=1S/C23H22BrN3O2S3/c1-3-5-11-31-23-18(25)16-15(13-6-8-14(24)9-7-13)17(22(28)29-4-2)19(27-20(16)32-23)21-26-10-12-30-21/h6-10,12H,3-5,11,25H2,1-2H3 |
| InChIKey | JHKREDXJOVWDII-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|