C19H20ClN5S3 — CID 142367156
2-(4-chlorobutylsulfanyl)-4-(2,3-dimethylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine (PubChem CID 142367156) has the molecular formula C19H20ClN5S3 and a molecular weight of 450.06 g/mol. Its IUPAC name is 2-(4-chlorobutylsulfanyl)-4-(2,3-dimethylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine.
| Compound Name | 2-(4-chlorobutylsulfanyl)-4-(2,3-dimethylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 142367156 |
| Molecular Formula | C19H20ClN5S3 |
| Molecular Weight | 450.06 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 2-(4-chlorobutylsulfanyl)-4-(2,3-dimethylimidazol-4-yl)-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
| SMILES | Cc1ncc(-c2cc(-c3nccs3)nc3sc(SCCCCCl)c(N)c23)n1C |
| InChI | InChI=1S/C19H20ClN5S3/c1-11-23-10-14(25(11)2)12-9-13(17-22-6-8-26-17)24-18-15(12)16(21)19(28-18)27-7-4-3-5-20/h6,8-10H,3-5,7,21H2,1-2H3 |
| InChIKey | WDWNEQDJYZDDMR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.06 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|