C18H20N6S3 — CID 142485844
6-butylsulfanyl-4-(2,3-dimethylimidazol-4-yl)-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine (PubChem CID 142485844) has the molecular formula C18H20N6S3 and a molecular weight of 416.60 g/mol. Its IUPAC name is 6-butylsulfanyl-4-(2,3-dimethylimidazol-4-yl)-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine.
| Compound Name | 6-butylsulfanyl-4-(2,3-dimethylimidazol-4-yl)-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 142485844 |
| Molecular Formula | C18H20N6S3 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 6-butylsulfanyl-4-(2,3-dimethylimidazol-4-yl)-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine |
| SMILES | CCCCSc1sc2nc(-c3nccs3)nc(-c3cnc(C)n3C)c2c1N |
| InChI | InChI=1S/C18H20N6S3/c1-4-5-7-26-18-13(19)12-14(11-9-21-10(2)24(11)3)22-15(23-16(12)27-18)17-20-6-8-25-17/h6,8-9H,4-5,7,19H2,1-3H3 |
| InChIKey | KPBLQCKDGJIABB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|