C23H25N3OS3 — CID 145170887
2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]propan-2-ol (PubChem CID 145170887) has the molecular formula C23H25N3OS3 and a molecular weight of 455.67 g/mol. Its IUPAC name is 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 145170887 |
| Molecular Formula | C23H25N3OS3 |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]propan-2-ol |
| SMILES | CCCCSc1sc2nc(-c3nccs3)cc(-c3ccc(C(C)(C)O)cc3)c2c1N |
| InChI | InChI=1S/C23H25N3OS3/c1-4-5-11-29-22-19(24)18-16(14-6-8-15(9-7-14)23(2,3)27)13-17(26-21(18)30-22)20-25-10-12-28-20/h6-10,12-13,27H,4-5,11,24H2,1-3H3 |
| InChIKey | WWSSKPRQMKXPCZ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|