C17H19N3O2S — CID 142486489
(3aR,6aR)-1-(4-pyridin-3-ylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 142486489) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is (3aR,6aR)-1-(4-pyridin-3-ylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aR)-1-(4-pyridin-3-ylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 142486489 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (3aR,6aR)-1-(4-pyridin-3-ylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | O=S(=O)(c1ccc(-c2cccnc2)cc1)N1CC[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C17H19N3O2S/c21-23(22,20-9-7-15-11-19-12-17(15)20)16-5-3-13(4-6-16)14-2-1-8-18-10-14/h1-6,8,10,15,17,19H,7,9,11-12H2/t15-,17+/m1/s1 |
| InChIKey | SXSPEGQPEJGRRM-WBVHZDCISA-N |
| XLogP | 1.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |