C10H9F3N2 — CID 14249019
methyl-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]diazene (PubChem CID 14249019) has the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. Its IUPAC name is methyl-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]diazene.
| Compound Name | methyl-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]diazene |
|---|---|
| PubChem CID | 14249019 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | methyl-[(Z)-3,3,3-trifluoro-1-phenylprop-1-enyl]diazene |
| SMILES | C/N=N/C(=C\C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H9F3N2/c1-14-15-9(7-10(11,12)13)8-5-3-2-4-6-8/h2-7H,1H3/b9-7-,15-14+ |
| InChIKey | JOHRPONEBZYJSL-DKWVFZHTSA-N |
| XLogP | 3.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|