C33H21ClIN3O4 — CID 142491710
2-(3-chlorophenyl)-N-[3-cyano-4-[4-(6-iodo-5-methyl-3-pyridinyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromen-2-yl]acetamide (PubChem CID 142491710) has the molecular formula C33H21ClIN3O4 and a molecular weight of 685.91 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[3-cyano-4-[4-(6-iodo-5-methyl-3-pyridinyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromen-2-yl]acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-[3-cyano-4-[4-(6-iodo-5-methyl-3-pyridinyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromen-2-yl]acetamide |
|---|---|
| PubChem CID | 142491710 |
| Molecular Formula | C33H21ClIN3O4 |
| Molecular Weight | 685.91 g/mol |
| Exact Mass | 685.03 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[3-cyano-4-[4-(6-iodo-5-methyl-3-pyridinyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromen-2-yl]acetamide |
| SMILES | Cc1cc(-c2ccc(C3C(C#N)=C(NC(=O)Cc4cccc(Cl)c4)Oc4c3c(=O)oc3ccccc43)cc2)cnc1I |
| InChI | InChI=1S/C33H21ClIN3O4/c1-18-13-22(17-37-31(18)35)20-9-11-21(12-10-20)28-25(16-36)32(38-27(39)15-19-5-4-6-23(34)14-19)42-30-24-7-2-3-8-26(24)41-33(40)29(28)30/h2-14,17,28H,15H2,1H3,(H,38,39) |
| InChIKey | MCCACWRNFXJYNZ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.91 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|