C27H31FN2O3 — CID 142494026
N-(4-amino-4-methylpentyl)-2-fluoro-3,4-bis(phenylmethoxy)benzamide (PubChem CID 142494026) has the molecular formula C27H31FN2O3 and a molecular weight of 450.55 g/mol. Its IUPAC name is N-(4-amino-4-methylpentyl)-2-fluoro-3,4-bis(phenylmethoxy)benzamide.
| Compound Name | N-(4-amino-4-methylpentyl)-2-fluoro-3,4-bis(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 142494026 |
| Molecular Formula | C27H31FN2O3 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-(4-amino-4-methylpentyl)-2-fluoro-3,4-bis(phenylmethoxy)benzamide |
| SMILES | CC(C)(N)CCCNC(=O)c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1F |
| InChI | InChI=1S/C27H31FN2O3/c1-27(2,29)16-9-17-30-26(31)22-14-15-23(32-18-20-10-5-3-6-11-20)25(24(22)28)33-19-21-12-7-4-8-13-21/h3-8,10-15H,9,16-19,29H2,1-2H3,(H,30,31) |
| InChIKey | WKVVUOOHMGQXQF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|