C31H33ClN8O4 — CID 142496077
6-chloro-N-methylpyridin-2-amine;1-[2-(3-formyl-2-azabicyclo[2.2.1]heptan-2-yl)-2-oxoethyl]-5-[(3-methylphenyl)carbamoylamino]indazole-3-carboxamide (PubChem CID 142496077) has the molecular formula C31H33ClN8O4 and a molecular weight of 617.11 g/mol. Its IUPAC name is 6-chloro-N-methylpyridin-2-amine;1-[2-(3-formyl-2-azabicyclo[2.2.1]heptan-2-yl)-2-oxoethyl]-5-[(3-methylphenyl)carbamoylamino]indazole-3-carboxamide.
| Compound Name | 6-chloro-N-methylpyridin-2-amine;1-[2-(3-formyl-2-azabicyclo[2.2.1]heptan-2-yl)-2-oxoethyl]-5-[(3-methylphenyl)carbamoylamino]indazole-3-carboxamide |
|---|---|
| PubChem CID | 142496077 |
| Molecular Formula | C31H33ClN8O4 |
| Molecular Weight | 617.11 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | 6-chloro-N-methylpyridin-2-amine;1-[2-(3-formyl-2-azabicyclo[2.2.1]heptan-2-yl)-2-oxoethyl]-5-[(3-methylphenyl)carbamoylamino]indazole-3-carboxamide |
| SMILES | CNc1cccc(Cl)n1.Cc1cccc(NC(=O)Nc2ccc3c(c2)c(C(N)=O)nn3CC(=O)N2C3CCC(C3)C2C=O)c1 |
| InChI | InChI=1S/C25H26N6O4.C6H7ClN2/c1-14-3-2-4-16(9-14)27-25(35)28-17-6-8-20-19(11-17)23(24(26)34)29-30(20)12-22(33)31-18-7-5-15(10-18)21(31)13-32;1-8-6-4-2-3-5(7)9-6/h2-4,6,8-9,11,13,15,18,21H,5,7,10,12H2,1H3,(H2,26,34)(H2,27,28,35);2-4H,1H3,(H,8,9) |
| InChIKey | GLWNQIXUURLATJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 164.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.11 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|