C39H27BrN4 — CID 142497327
4-[3-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N,N-diphenylaniline (PubChem CID 142497327) has the molecular formula C39H27BrN4 and a molecular weight of 631.58 g/mol. Its IUPAC name is 4-[3-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N,N-diphenylaniline.
| Compound Name | 4-[3-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 142497327 |
| Molecular Formula | C39H27BrN4 |
| Molecular Weight | 631.58 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | 4-[3-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N,N-diphenylaniline |
| SMILES | Brc1cc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C39H27BrN4/c40-33-26-31(28-21-23-36(24-22-28)44(34-17-9-3-10-18-34)35-19-11-4-12-20-35)25-32(27-33)39-42-37(29-13-5-1-6-14-29)41-38(43-39)30-15-7-2-8-16-30/h1-27H |
| InChIKey | NWODPYJIOXSBRU-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.58 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |