C57H80N2 — CID 142500153
2-N,7-N-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-9,9-dihexyl-2-N,7-N-dimethylfluorene-2,7-diamine (PubChem CID 142500153) has the molecular formula C57H80N2 and a molecular weight of 793.28 g/mol. Its IUPAC name is 2-N,7-N-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-9,9-dihexyl-2-N,7-N-dimethylfluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-9,9-dihexyl-2-N,7-N-dimethylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 142500153 |
| Molecular Formula | C57H80N2 |
| Molecular Weight | 793.28 g/mol |
| Exact Mass | 792.63 |
| IUPAC Name | 2-N,7-N-bis(1,1,2,2,3,3-hexamethylinden-5-yl)-9,9-dihexyl-2-N,7-N-dimethylfluorene-2,7-diamine |
| SMILES | CCCCCCC1(CCCCCC)c2cc(N(C)c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)ccc2-c2ccc(N(C)c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)cc21 |
| InChI | InChI=1S/C57H80N2/c1-17-19-21-23-33-57(34-24-22-20-18-2)47-35-39(58(15)41-27-31-45-49(37-41)53(7,8)55(11,12)51(45,3)4)25-29-43(47)44-30-26-40(36-48(44)57)59(16)42-28-32-46-50(38-42)54(9,10)56(13,14)52(46,5)6/h25-32,35-38H,17-24,33-34H2,1-16H3 |
| InChIKey | QZHFPMDKPRUYOS-UHFFFAOYSA-N |
| XLogP | 16.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.28 |
| LogP ≤ 5 | 16.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|