C25H32N4O5 — CID 142501027
1-ethyl-N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-2-oxopyridine-3-carboxamide (PubChem CID 142501027) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is 1-ethyl-N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-2-oxopyridine-3-carboxamide.
| Compound Name | 1-ethyl-N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 142501027 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 1-ethyl-N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-2-oxopyridine-3-carboxamide |
| SMILES | CCn1cccc(C(=O)Nc2cc3c(cc2N2CCOCC2)C(=O)N(CCC(C)(C)O)C3)c1=O |
| InChI | InChI=1S/C25H32N4O5/c1-4-27-8-5-6-18(23(27)31)22(30)26-20-14-17-16-29(9-7-25(2,3)33)24(32)19(17)15-21(20)28-10-12-34-13-11-28/h5-6,8,14-15,33H,4,7,9-13,16H2,1-3H3,(H,26,30) |
| InChIKey | DZPMPUCAKVYZHN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|