C26H34N4O5 — CID 142501123
N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-6-[(1R)-1-methoxyethyl]pyridine-2-carboxamide (PubChem CID 142501123) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-6-[(1R)-1-methoxyethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-6-[(1R)-1-methoxyethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142501123 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-6-[(1R)-1-methoxyethyl]pyridine-2-carboxamide |
| SMILES | CO[C@H](C)c1cccc(C(=O)Nc2cc3c(cc2N2CCOCC2)C(=O)N(CCC(C)(C)O)C3)n1 |
| InChI | InChI=1S/C26H34N4O5/c1-17(34-4)20-6-5-7-21(27-20)24(31)28-22-14-18-16-30(9-8-26(2,3)33)25(32)19(18)15-23(22)29-10-12-35-13-11-29/h5-7,14-15,17,33H,8-13,16H2,1-4H3,(H,28,31)/t17-/m1/s1 |
| InChIKey | DPZZRYGBPAQQQC-QGZVFWFLSA-N |
| XLogP | 2.99 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|