C28H35N5O5 — CID 142501115
N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-1-methyl-2-oxopyridine-3-carboxamide;2-methylprop-2-enenitrile (PubChem CID 142501115) has the molecular formula C28H35N5O5 and a molecular weight of 521.62 g/mol. Its IUPAC name is N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-1-methyl-2-oxopyridine-3-carboxamide;2-methylprop-2-enenitrile.
| Compound Name | N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-1-methyl-2-oxopyridine-3-carboxamide;2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 142501115 |
| Molecular Formula | C28H35N5O5 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | N-[2-(3-hydroxy-3-methylbutyl)-6-morpholin-4-yl-1-oxo-3H-isoindol-5-yl]-1-methyl-2-oxopyridine-3-carboxamide;2-methylprop-2-enenitrile |
| SMILES | C=C(C)C#N.Cn1cccc(C(=O)Nc2cc3c(cc2N2CCOCC2)C(=O)N(CCC(C)(C)O)C3)c1=O |
| InChI | InChI=1S/C24H30N4O5.C4H5N/c1-24(2,32)6-8-28-15-16-13-19(25-21(29)17-5-4-7-26(3)22(17)30)20(14-18(16)23(28)31)27-9-11-33-12-10-27;1-4(2)3-5/h4-5,7,13-14,32H,6,8-12,15H2,1-3H3,(H,25,29);1H2,2H3 |
| InChIKey | DLUYEFBBJWLTMQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|