C18H16ClF3N4O3 — CID 142503876
N-[2-[2-chloro-4-(trifluoromethyl)phenoxy]ethyl]-2-(cyclopropanecarbonylamino)pyrimidine-4-carboxamide (PubChem CID 142503876) has the molecular formula C18H16ClF3N4O3 and a molecular weight of 428.80 g/mol. Its IUPAC name is N-[2-[2-chloro-4-(trifluoromethyl)phenoxy]ethyl]-2-(cyclopropanecarbonylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[2-[2-chloro-4-(trifluoromethyl)phenoxy]ethyl]-2-(cyclopropanecarbonylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 142503876 |
| Molecular Formula | C18H16ClF3N4O3 |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-[2-[2-chloro-4-(trifluoromethyl)phenoxy]ethyl]-2-(cyclopropanecarbonylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(F)(F)F)cc1Cl)c1ccnc(NC(=O)C2CC2)n1 |
| InChI | InChI=1S/C18H16ClF3N4O3/c19-12-9-11(18(20,21)22)3-4-14(12)29-8-7-23-16(28)13-5-6-24-17(25-13)26-15(27)10-1-2-10/h3-6,9-10H,1-2,7-8H2,(H,23,28)(H,24,25,26,27) |
| InChIKey | HZBADLPWWCLLKJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|