C26H22O — CID 142505023
4-[3-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phenyl]dibenzofuran (PubChem CID 142505023) has the molecular formula C26H22O and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-[3-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phenyl]dibenzofuran.
| Compound Name | 4-[3-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phenyl]dibenzofuran |
|---|---|
| PubChem CID | 142505023 |
| Molecular Formula | C26H22O |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-[3-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phenyl]dibenzofuran |
| SMILES | C=C/C=C(\C=C/C)Cc1cccc(-c2cccc3c2oc2ccccc23)c1 |
| InChI | InChI=1S/C26H22O/c1-3-9-19(10-4-2)17-20-11-7-12-21(18-20)22-14-8-15-24-23-13-5-6-16-25(23)27-26(22)24/h3-16,18H,1,17H2,2H3/b10-4-,19-9+ |
| InChIKey | LMZKKQGUQYEABV-CEHPQUIGSA-N |
| XLogP | 7.48 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|