About 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde
6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde (PubChem CID 142505392) has the molecular formula C16H10N2O2
and a molecular weight of 262.27 g/mol. Its IUPAC name is 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde |
| PubChem CID | 142505392 |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde |
| SMILES | O=Cc1c(-c2ccc3ccccc3c2)nc2occn12 |
| InChI | InChI=1S/C16H10N2O2/c19-10-14-15(17-16-18(14)7-8-20-16)13-6-5-11-3-1-2-4-12(11)9-13/h1-10H |
| InChIKey | TZPVALFQXXZKLG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 47.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde?
The IUPAC name of 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde (CID 142505392) is 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde.
What is the SMILES notation for 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde?
The canonical SMILES for 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde is O=Cc1c(-c2ccc3ccccc3c2)nc2occn12.
What is the InChIKey of 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde?
The InChIKey is TZPVALFQXXZKLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O2/c19-10-14-15(17-16-18(14)7-8-20-16)13-6-5-11-3-1-2-4-12(11)9-13/h1-10H.
What are the key properties of 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde?
6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde has a molecular weight of 262.27 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carbaldehyde is sourced from PubChem (CID 142505392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).