C20H31N3 — CID 142506286
N-methyl-3-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]hepta-1,6-dien-2-amine (PubChem CID 142506286) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is N-methyl-3-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]hepta-1,6-dien-2-amine.
| Compound Name | N-methyl-3-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]hepta-1,6-dien-2-amine |
|---|---|
| PubChem CID | 142506286 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | N-methyl-3-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]hepta-1,6-dien-2-amine |
| SMILES | C=CCCC(Cc1ccc(N2CCN(C)CC2)cc1)C(=C)NC |
| InChI | InChI=1S/C20H31N3/c1-5-6-7-19(17(2)21-3)16-18-8-10-20(11-9-18)23-14-12-22(4)13-15-23/h5,8-11,19,21H,1-2,6-7,12-16H2,3-4H3 |
| InChIKey | NNSZUOGOUDCKDO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|