C22H21NO4 — CID 142510043
methyl 1-[(2S,5S)-5-(phenylmethoxymethyl)-2,5-dihydrofuran-2-yl]indole-3-carboxylate (PubChem CID 142510043) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl 1-[(2S,5S)-5-(phenylmethoxymethyl)-2,5-dihydrofuran-2-yl]indole-3-carboxylate.
| Compound Name | methyl 1-[(2S,5S)-5-(phenylmethoxymethyl)-2,5-dihydrofuran-2-yl]indole-3-carboxylate |
|---|---|
| PubChem CID | 142510043 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | methyl 1-[(2S,5S)-5-(phenylmethoxymethyl)-2,5-dihydrofuran-2-yl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn([C@@H]2C=C[C@@H](COCc3ccccc3)O2)c2ccccc12 |
| InChI | InChI=1S/C22H21NO4/c1-25-22(24)19-13-23(20-10-6-5-9-18(19)20)21-12-11-17(27-21)15-26-14-16-7-3-2-4-8-16/h2-13,17,21H,14-15H2,1H3/t17-,21-/m0/s1 |
| InChIKey | HWBNVDCYFRFRKU-UWJYYQICSA-N |
| XLogP | 4.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|